CAS 2642377-57-7 is the registry number for ((2S,4R,5S)-5-Amino-4-methoxytetrahydro-2H-pyran-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4R,5S)-5-amino-4-methoxyoxan-2-yl]methanol (CAS 2642377-57-7) is a chemical compound with the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. IUPAC name: [(2S,4R,5S)-5-amino-4-methoxyoxan-2-yl]methanol. InChIKey: IZLTYUVTSIQXMG-LYFYHCNISA-N.
| Molecular formula | C7H15NO3 |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | [(2S,4R,5S)-5-amino-4-methoxyoxan-2-yl]methanol |
| InChIKey | IZLTYUVTSIQXMG-LYFYHCNISA-N |
| SMILES | CO[C@@H]1C[C@H](OC[C@@H]1N)CO |
Computed by PubChem (NCBI)