CAS 2642615-23-2 is the registry number for 7-Bromo-3-iodo-4H-pyrido[1,2-a]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3-iodopyrido[1,2-a]pyrimidin-4-one (CAS 2642615-23-2) is a chemical compound with the molecular formula C8H4BrIN2O and a molecular weight of 350.94 g/mol. IUPAC name: 7-bromo-3-iodopyrido[1,2-a]pyrimidin-4-one. InChIKey: PTRUNVWDVVNBBC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrIN2O |
|---|---|
| Molecular weight | 350.94 g/mol |
| IUPAC name | 7-bromo-3-iodopyrido[1,2-a]pyrimidin-4-one |
| InChIKey | PTRUNVWDVVNBBC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=O)N2C=C1Br)I |
Computed by PubChem (NCBI)