Products 2643320-62-9

CAS 2643320-62-9 is the registry number for ERAP1 modulator-2. Offered by: MedChemExpress. Available pack sizes: 25 mg, 1 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

4-ethyl-3-[[2-(1-methylpiperidin-2-yl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid (CAS 2643320-62-9) is a chemical compound with the molecular formula C22H25F3N2O4S and a molecular weight of 470.5 g/mol. IUPAC name: 4-ethyl-3-[[2-(1-methylpiperidin-2-yl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid. InChIKey: CJIMNQIMUSLTJH-UHFFFAOYSA-N.

Identity
Molecular formulaC22H25F3N2O4S
Molecular weight470.5 g/mol
IUPAC name4-ethyl-3-[[2-(1-methylpiperidin-2-yl)-5-(trifluoromethyl)phenyl]sulfamoyl]benzoic acid
InChIKeyCJIMNQIMUSLTJH-UHFFFAOYSA-N
SMILESCCC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NC2=C(C=CC(=C2)C(F)(F)F)C3CCCCN3C

Computed by PubChem (NCBI)

Synonyms: orb2945753