CAS 2643367-73-9 is the registry number for 4-(4-Bromo-2,5-dimethylphenyl)-2-chloropyridine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-(4-bromo-2,5-dimethylphenyl)-2-chloropyridine (CAS 2643367-73-9) is a chemical compound with the molecular formula C13H11BrClN and a molecular weight of 296.59 g/mol. IUPAC name: 4-(4-bromo-2,5-dimethylphenyl)-2-chloropyridine. InChIKey: GPMGLLJDKYAETC-UHFFFAOYSA-N.
| Molecular formula | C13H11BrClN |
|---|---|
| Molecular weight | 296.59 g/mol |
| IUPAC name | 4-(4-bromo-2,5-dimethylphenyl)-2-chloropyridine |
| InChIKey | GPMGLLJDKYAETC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)