CAS 26437-48-9 appears in our catalog under these names: Tris(2–pyridyl)phosphine, Tris(2-pyridyl)phosphine 98%, Tris(2-pyridyl)phosphine, 96%, 96%, Tris(2-pyridyl)phosphine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
Tripyridin-2-ylphosphane (CAS 26437-48-9) is a chemical compound with the molecular formula C15H12N3P and a molecular weight of 265.25 g/mol. IUPAC name: tripyridin-2-ylphosphane. InChIKey: LDSMXGPRCFQXSK-UHFFFAOYSA-N.
| Molecular formula | C15H12N3P |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | tripyridin-2-ylphosphane |
| InChIKey | LDSMXGPRCFQXSK-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)P(C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)