CAS 2643943-12-6 is the registry number for (R)-2-Chloro-7-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(7R)-2-chloro-7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol (CAS 2643943-12-6) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: (7R)-2-chloro-7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol. InChIKey: CIYRZICGBQOSHI-SNVBAGLBSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | (7R)-2-chloro-7-ethyl-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| InChIKey | CIYRZICGBQOSHI-SNVBAGLBSA-N |
| SMILES | CC[C@]1(CCC2=C1N=C(C=C2)Cl)O |
Computed by PubChem (NCBI)