CAS 2645412-16-2 is the registry number for 2,4-dibromo-3,5,6-trideuterio-aniline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
2,4-dibromo-3,5,6-trideuterioaniline (CAS 2645412-16-2) is a chemical compound with the molecular formula C6H5Br2N and a molecular weight of 253.94 g/mol. IUPAC name: 2,4-dibromo-3,5,6-trideuterioaniline. InChIKey: DYSRXWYRUJCNFI-CBYSEHNBSA-N.
| Molecular formula | C6H5Br2N |
|---|---|
| Molecular weight | 253.94 g/mol |
| IUPAC name | 2,4-dibromo-3,5,6-trideuterioaniline |
| InChIKey | DYSRXWYRUJCNFI-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)Br)[2H])Br)[2H] |
Computed by PubChem (NCBI)