CAS 26475-18-3 appears in our catalog under these names: 4,4'-Dimethyloctafluorobiphenyl, 95%, 2,2',3,3',5,5',6,6'-Octafluoro-4,4'-dimethyl-1,1'-biphenyl, 95%, 2,2',3,3',5,5',6,6'-Octafluoro-4,4'-dimethyl-1,1'-biphenyl 95%. Offered by: Combi-blocks, Chemat Brand, Ambeed. Available pack sizes: 1g, on request, 100mg, 250mg.
1,2,4,5-tetrafluoro-3-methyl-6-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene (CAS 26475-18-3) is a chemical compound with the molecular formula C14H6F8 and a molecular weight of 326.18 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-methyl-6-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene. InChIKey: IMAVLXWSVGAOCU-UHFFFAOYSA-N.
| Molecular formula | C14H6F8 |
|---|---|
| Molecular weight | 326.18 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-methyl-6-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene |
| InChIKey | IMAVLXWSVGAOCU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)C2=C(C(=C(C(=C2F)F)C)F)F)F)F |
Computed by PubChem (NCBI)