Products 2647877-84-5
CAS 2647877-84-5 appears in our catalog under these names: LX1, 99.13%, LX1, 98%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 25 mg, 5 mg, 50 mg, 10 mg, 1mg, 5mg, 10mg, 50mg.
5-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxybenzamide (CAS 2647877-84-5) is a chemical compound with the molecular formula C22H15F6NO2 and a molecular weight of 439.3 g/mol. IUPAC name: 5-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxybenzamide. InChIKey: VAXWPMCTIJBPLN-UHFFFAOYSA-N.
| Molecular formula | C22H15F6NO2 |
|---|---|
| Molecular weight | 439.3 g/mol |
| IUPAC name | 5-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxybenzamide |
| InChIKey | VAXWPMCTIJBPLN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C=C2)O)C(=O)NC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)