CAS 2648-47-7 appears in our catalog under these names: 5H-Octafluoropentanal, 95%, 5H-Octafluoropentanal, Technical Grade. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 100mg.
2,2,3,3,4,4,5,5-octafluoropentanal (CAS 2648-47-7) is a chemical compound with the molecular formula C5H2F8O and a molecular weight of 230.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluoropentanal. InChIKey: BQFRALWVZATVGY-UHFFFAOYSA-N.
| Molecular formula | C5H2F8O |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluoropentanal |
| InChIKey | BQFRALWVZATVGY-UHFFFAOYSA-N |
| SMILES | C(=O)C(C(C(C(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)