Products 2648377-08-4
CAS 2648377-08-4 is the registry number for KB-0118. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5,7-trihydroxy-2-(1H-indol-6-yl)chromen-4-one (CAS 2648377-08-4) is a chemical compound with the molecular formula C17H11NO5 and a molecular weight of 309.27 g/mol. IUPAC name: 3,5,7-trihydroxy-2-(1H-indol-6-yl)chromen-4-one. InChIKey: SWNCQOAQTWQJDR-UHFFFAOYSA-N.
| Molecular formula | C17H11NO5 |
|---|---|
| Molecular weight | 309.27 g/mol |
| IUPAC name | 3,5,7-trihydroxy-2-(1H-indol-6-yl)chromen-4-one |
| InChIKey | SWNCQOAQTWQJDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2)C3=C(C(=O)C4=C(C=C(C=C4O3)O)O)O |
Computed by PubChem (NCBI)