CAS 2648773-62-8 is the registry number for 8-Bromo-2-(trifluoromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one (CAS 2648773-62-8) is a chemical compound with the molecular formula C9H4BrF3N2O and a molecular weight of 293.04 g/mol. IUPAC name: 8-bromo-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one. InChIKey: GIORHHOMGUOWSA-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3N2O |
|---|---|
| Molecular weight | 293.04 g/mol |
| IUPAC name | 8-bromo-2-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | GIORHHOMGUOWSA-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=CC2=O)C(F)(F)F)C=C1Br |
Computed by PubChem (NCBI)