CAS 2648855-18-7 appears in our catalog under these names: RK–701, RK-701, 98.01%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10 mg, 5 mg, 100 mg, 50 mg, 25 mg, 1 mg.
N-[(2S)-1-(4-cyanoanilino)-4-cyclopropyl-1-oxobutan-2-yl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide (CAS 2648855-18-7) is a chemical compound with the molecular formula C26H30N4O3 and a molecular weight of 446.5 g/mol. IUPAC name: N-[(2S)-1-(4-cyanoanilino)-4-cyclopropyl-1-oxobutan-2-yl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide. InChIKey: OWORSODZTADOQX-IBGZPJMESA-N.
| Molecular formula | C26H30N4O3 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | N-[(2S)-1-(4-cyanoanilino)-4-cyclopropyl-1-oxobutan-2-yl]-3,6,6-trimethyl-4-oxo-5,7-dihydro-1H-indole-2-carboxamide |
| InChIKey | OWORSODZTADOQX-IBGZPJMESA-N |
| SMILES | CC1=C(NC2=C1C(=O)CC(C2)(C)C)C(=O)N[C@@H](CCC3CC3)C(=O)NC4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)