CAS 2648944-13-0 is the registry number for tert-Butyl 2-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylate 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,2-dioxo-2lambda6-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylate (CAS 2648944-13-0) is a chemical compound with the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. IUPAC name: tert-butyl 2,2-dioxo-2lambda6-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylate. InChIKey: SHNFVCWYPHENFN-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O4S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | tert-butyl 2,2-dioxo-2lambda6-thia-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| InChIKey | SHNFVCWYPHENFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNS(=O)(=O)N2 |
Computed by PubChem (NCBI)