Products 2649-68-5
CAS 2649-68-5 is the registry number for Clovanediol diacetate. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, Get quote.
[(1S,2S,5S,8R,9R)-2-acetyloxy-4,4,8-trimethyl-9-tricyclo[6.3.1.01,5]dodecanyl] acetate (CAS 2649-68-5) is a chemical compound with the molecular formula C19H30O4 and a molecular weight of 322.4 g/mol. IUPAC name: [(1S,2S,5S,8R,9R)-2-acetyloxy-4,4,8-trimethyl-9-tricyclo[6.3.1.01,5]dodecanyl] acetate. InChIKey: ILEDHMVFQOCEJU-CTRAYCPCSA-N.
| Molecular formula | C19H30O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | [(1S,2S,5S,8R,9R)-2-acetyloxy-4,4,8-trimethyl-9-tricyclo[6.3.1.01,5]dodecanyl] acetate |
| InChIKey | ILEDHMVFQOCEJU-CTRAYCPCSA-N |
| SMILES | CC(=O)O[C@@H]1CC[C@]23C[C@]1(CC[C@H]2C(C[C@@H]3OC(=O)C)(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
Clovanediol, diacetate, orb1681395