Products 2649050-95-1

CAS 2649050-95-1 is the registry number for 2-Bromo-4′-chloro-4-(1,1-dimethylethyl)-1,1′-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-bromo-4-tert-butyl-1-(4-chlorophenyl)benzene (CAS 2649050-95-1) is a chemical compound with the molecular formula C16H16BrCl and a molecular weight of 323.65 g/mol. IUPAC name: 2-bromo-4-tert-butyl-1-(4-chlorophenyl)benzene. InChIKey: WXKUQOMEMWGSTI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16BrCl
Molecular weight323.65 g/mol
IUPAC name2-bromo-4-tert-butyl-1-(4-chlorophenyl)benzene
InChIKeyWXKUQOMEMWGSTI-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC(=C(C=C1)C2=CC=C(C=C2)Cl)Br

Computed by PubChem (NCBI)