CAS 2649055-29-6 appears in our catalog under these names: 1-Chloro-2,3-dimethylbenzene 4-chloro-1,2-dimethylbenzene, 95%, 1-Chloro-2,3-dimethylbenzene, 4-chloro-1,2-dimethylbenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
1-chloro-2,3-dimethylbenzene;4-chloro-1,2-dimethylbenzene (CAS 2649055-29-6) is a chemical compound with the molecular formula C16H18Cl2 and a molecular weight of 281.2 g/mol. IUPAC name: 1-chloro-2,3-dimethylbenzene;4-chloro-1,2-dimethylbenzene. InChIKey: PYBWEBDHSKHWPR-UHFFFAOYSA-N.
| Molecular formula | C16H18Cl2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 1-chloro-2,3-dimethylbenzene;4-chloro-1,2-dimethylbenzene |
| InChIKey | PYBWEBDHSKHWPR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)C.CC1=C(C=C(C=C1)Cl)C |
Computed by PubChem (NCBI)