CAS 2649276-67-3 is the registry number for 2-Cyano-5-fluorophenyl Trifluoromethanesulfonate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g.
(2-cyano-5-fluorophenyl) trifluoromethanesulfonate (CAS 2649276-67-3) is a chemical compound with the molecular formula C8H3F4NO3S and a molecular weight of 269.17 g/mol. IUPAC name: (2-cyano-5-fluorophenyl) trifluoromethanesulfonate. InChIKey: GBYTZTLCMJZFBF-UHFFFAOYSA-N.
| Molecular formula | C8H3F4NO3S |
|---|---|
| Molecular weight | 269.17 g/mol |
| IUPAC name | (2-cyano-5-fluorophenyl) trifluoromethanesulfonate |
| InChIKey | GBYTZTLCMJZFBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OS(=O)(=O)C(F)(F)F)C#N |
Computed by PubChem (NCBI)