CAS 26501-54-2 appears in our catalog under these names: Tetrabutylammonium nitrite, 95%, Tetrabutylammonium nitrite, TETRABUTYLAMMONIUM NITRITE, >=97.0%, Tetrabutylammonium nitrite, 98%, 98%, Tetrabutylammonium (nitrite), 95.0%. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 10g, 1g, 50g, 250mg, 15g, Get quote.
Tetrabutylazanium nitrite (CAS 26501-54-2) is a chemical compound with the molecular formula C16H36N2O2 and a molecular weight of 288.47 g/mol. IUPAC name: tetrabutylazanium nitrite. InChIKey: SHRKDVQQQPFSIY-UHFFFAOYSA-M.
| Molecular formula | C16H36N2O2 |
|---|---|
| Molecular weight | 288.47 g/mol |
| IUPAC name | tetrabutylazanium nitrite |
| InChIKey | SHRKDVQQQPFSIY-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.N(=O)[O-] |
Computed by PubChem (NCBI)