Products 2651226-48-9
CAS 2651226-48-9 is the registry number for 6-Bromo-1-methyl-1,5-naphthyridine-2,4(1H,3H)-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-1-methyl-1,5-naphthyridine-2,4-dione (CAS 2651226-48-9) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 6-bromo-1-methyl-1,5-naphthyridine-2,4-dione. InChIKey: SXXUQSJWQLOVCA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 6-bromo-1-methyl-1,5-naphthyridine-2,4-dione |
| InChIKey | SXXUQSJWQLOVCA-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(=O)C2=C1C=CC(=N2)Br |
Computed by PubChem (NCBI)