CAS 26526-57-8 is the registry number for 5-(Adamantan-1-yl)-1,3,4-thiadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(1-adamantyl)-1,3,4-thiadiazol-2-amine (CAS 26526-57-8) is a chemical compound with the molecular formula C12H17N3S and a molecular weight of 235.35 g/mol. IUPAC name: 5-(1-adamantyl)-1,3,4-thiadiazol-2-amine. InChIKey: FBIPRWDBYYCKHA-UHFFFAOYSA-N.
| Molecular formula | C12H17N3S |
|---|---|
| Molecular weight | 235.35 g/mol |
| IUPAC name | 5-(1-adamantyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | FBIPRWDBYYCKHA-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=NN=C(S4)N |
Computed by PubChem (NCBI)