Products 265319-66-2
CAS 265319-66-2 is the registry number for (alphaR)-alpha-Cyclohexyl-alpha-hydroxybenzeneacetate D-Tyrosine Methyl Ester. Offered by: TRC. Available pack sizes: 5g.
(2R)-2-cyclohexyl-2-hydroxy-2-phenylacetic acid;methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate (CAS 265319-66-2) is a chemical compound with the molecular formula C24H31NO6 and a molecular weight of 429.5 g/mol. IUPAC name: (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetic acid;methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate. InChIKey: PDXYUESSZXEVDX-UEGVITMISA-N.
| Molecular formula | C24H31NO6 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | (2R)-2-cyclohexyl-2-hydroxy-2-phenylacetic acid;methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate |
| InChIKey | PDXYUESSZXEVDX-UEGVITMISA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)O)N.C1CCC(CC1)[C@@](C2=CC=CC=C2)(C(=O)O)O |
Computed by PubChem (NCBI)