CAS 2653201-96-6 is the registry number for 6-Bromo-8-fluoro-2,2-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-fluoro-2,2-dimethyl-3H-imidazo[1,2-a]pyridine (CAS 2653201-96-6) is a chemical compound with the molecular formula C9H10BrFN2 and a molecular weight of 245.09 g/mol. IUPAC name: 6-bromo-8-fluoro-2,2-dimethyl-3H-imidazo[1,2-a]pyridine. InChIKey: GZIOAWVASLZEKU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFN2 |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 6-bromo-8-fluoro-2,2-dimethyl-3H-imidazo[1,2-a]pyridine |
| InChIKey | GZIOAWVASLZEKU-UHFFFAOYSA-N |
| SMILES | CC1(CN2C=C(C=C(C2=N1)F)Br)C |
Computed by PubChem (NCBI)