CAS 265330-98-1 appears in our catalog under these names: 5–ETHOXY–5–OXOPENTYLZINC BROMIDE, 4-(Ethoxycarbonyl)butylzinc bromide, 0.5M in THF, packaged u, 5-ETHOXY-5-OXOPENTYLZINC BROMIDE, 0.5M &. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 50ml.
Bromozinc(1+);ethyl pentanoate (CAS 265330-98-1) is a chemical compound with the molecular formula C7H13BrO2Zn and a molecular weight of 274.5 g/mol. IUPAC name: bromozinc(1+);ethyl pentanoate. InChIKey: JJSSUZYKRQXNFR-UHFFFAOYSA-M.
| Molecular formula | C7H13BrO2Zn |
|---|---|
| Molecular weight | 274.5 g/mol |
| IUPAC name | bromozinc(1+);ethyl pentanoate |
| InChIKey | JJSSUZYKRQXNFR-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CCC[CH2-].[Zn+]Br |
Computed by PubChem (NCBI)