CAS 2653346-83-7 is the registry number for Antibacterial agent 313. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N,1-trimethyl-2-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]quinolin-1-ium-6-amine iodide (CAS 2653346-83-7) is a chemical compound with the molecular formula C24H28IN3 and a molecular weight of 485.4 g/mol. IUPAC name: N,N,1-trimethyl-2-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]quinolin-1-ium-6-amine iodide. InChIKey: SPERNNDQDMZCSP-UHFFFAOYSA-M.
| Molecular formula | C24H28IN3 |
|---|---|
| Molecular weight | 485.4 g/mol |
| IUPAC name | N,N,1-trimethyl-2-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]quinolin-1-ium-6-amine iodide |
| InChIKey | SPERNNDQDMZCSP-UHFFFAOYSA-M |
| SMILES | C[N+]1=C(C=CC2=C1C=CC(=C2)N(C)C)/C=C/C3=CC=C(C=C3)N4CCCC4.[I-] |
Computed by PubChem (NCBI)