CAS 26537-88-2 appears in our catalog under these names: 2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol, 95%, 2-Perfluoropropoxy-2,3,3,3-tetrafluoropropanol, >95% (GC). Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 25g, 1g, 100mg, 500mg, 50mg.
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-ol (CAS 26537-88-2) is a chemical compound with the molecular formula C6H3F11O2 and a molecular weight of 316.07 g/mol. IUPAC name: 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-ol. InChIKey: MSOLHCPBFWYOSH-UHFFFAOYSA-N.
| Molecular formula | C6H3F11O2 |
|---|---|
| Molecular weight | 316.07 g/mol |
| IUPAC name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-ol |
| InChIKey | MSOLHCPBFWYOSH-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)O |
Computed by PubChem (NCBI)