CAS 2654052-27-2 is the registry number for tert-Butyl (5-bromo-6-methoxypyridin-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(5-bromo-6-methoxy-2-pyridinyl)carbamate (CAS 2654052-27-2) is a chemical compound with the molecular formula C11H15BrN2O3 and a molecular weight of 303.15 g/mol. IUPAC name: tert-butyl N-(5-bromo-6-methoxy-2-pyridinyl)carbamate. InChIKey: GYLZPBDEPTVLDA-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O3 |
|---|---|
| Molecular weight | 303.15 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-6-methoxy-2-pyridinyl)carbamate |
| InChIKey | GYLZPBDEPTVLDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=C(C=C1)Br)OC |
Computed by PubChem (NCBI)