Products 2654746-31-1
CAS 2654746-31-1 is the registry number for tert-Butyl (R)-(1-(3-bromo-2,5-difluorophenyl)ethyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R)-1-(3-bromo-2,5-difluorophenyl)ethyl]carbamate (CAS 2654746-31-1) is a chemical compound with the molecular formula C13H16BrF2NO2 and a molecular weight of 336.17 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(3-bromo-2,5-difluorophenyl)ethyl]carbamate. InChIKey: MJWAOTZHUWOHFY-SSDOTTSWSA-N.
| Molecular formula | C13H16BrF2NO2 |
|---|---|
| Molecular weight | 336.17 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(3-bromo-2,5-difluorophenyl)ethyl]carbamate |
| InChIKey | MJWAOTZHUWOHFY-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=C(C(=CC(=C1)F)Br)F)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)