Products 2654747-32-5
CAS 2654747-32-5 is the registry number for Methyl 2-acetyl-5-bromo-4-(trifluoromethyl)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-acetyl-5-bromo-4-(trifluoromethyl)benzoate (CAS 2654747-32-5) is a chemical compound with the molecular formula C11H8BrF3O3 and a molecular weight of 325.08 g/mol. IUPAC name: methyl 2-acetyl-5-bromo-4-(trifluoromethyl)benzoate. InChIKey: POHLQKZAHBSNIS-UHFFFAOYSA-N.
| Molecular formula | C11H8BrF3O3 |
|---|---|
| Molecular weight | 325.08 g/mol |
| IUPAC name | methyl 2-acetyl-5-bromo-4-(trifluoromethyl)benzoate |
| InChIKey | POHLQKZAHBSNIS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1C(=O)OC)Br)C(F)(F)F |
Computed by PubChem (NCBI)