CAS 26549-21-3 appears in our catalog under these names: (S,S)-(+)-2,3-Dimethoxy-1,4-bis(dimethylamino)butane, 95%, (S,S)–(+)–2,3–Dimethoxy–1,4–bis(dimethylamino)butane, (2S,3S)-2,3-Dimethoxy-N1,N1,N4,N4-tetramethylbutane-1,4-diamine. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 200mg.
(2S,3S)-2,3-dimethoxy-N,N,N',N'-tetramethylbutane-1,4-diamine (CAS 26549-21-3) is a chemical compound with the molecular formula C10H24N2O2 and a molecular weight of 204.31 g/mol. IUPAC name: (2S,3S)-2,3-dimethoxy-N,N,N',N'-tetramethylbutane-1,4-diamine. InChIKey: VYQCQNCBTMHEFI-UWVGGRQHSA-N.
| Molecular formula | C10H24N2O2 |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (2S,3S)-2,3-dimethoxy-N,N,N',N'-tetramethylbutane-1,4-diamine |
| InChIKey | VYQCQNCBTMHEFI-UWVGGRQHSA-N |
| SMILES | CN(C)C[C@@H]([C@H](CN(C)C)OC)OC |
Computed by PubChem (NCBI)