Products 2655608-68-5
CAS 2655608-68-5 is the registry number for tert-Butyl 2-(5-bromo-3-fluoropyridin-2-yl)-2-cyanoacetate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2-(5-bromo-3-fluoro-2-pyridinyl)-2-cyanoacetate (CAS 2655608-68-5) is a chemical compound with the molecular formula C12H12BrFN2O2 and a molecular weight of 315.14 g/mol. IUPAC name: tert-butyl 2-(5-bromo-3-fluoro-2-pyridinyl)-2-cyanoacetate. InChIKey: LZPKDLBJDXABQN-UHFFFAOYSA-N.
| Molecular formula | C12H12BrFN2O2 |
|---|---|
| Molecular weight | 315.14 g/mol |
| IUPAC name | tert-butyl 2-(5-bromo-3-fluoro-2-pyridinyl)-2-cyanoacetate |
| InChIKey | LZPKDLBJDXABQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C#N)C1=C(C=C(C=N1)Br)F |
Computed by PubChem (NCBI)