Products 26562-81-2
CAS 26562-81-2 appears in our catalog under these names: Adamantane–1，3–diamine dihydrochloride, 1,3-Adamantanediamine dihydrochloride, Adamantane-1,3-diamine dihydrochloride 97%, Adamantane-1,3-diamine dihydrochloride, 95%, 95%, Adamantane-1,3-diamine dihydrochloride, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 50mg, 500mg, 25g.
Adamantane-1,3-diamine;dihydrochloride (CAS 26562-81-2) is a chemical compound with the molecular formula C10H20Cl2N2 and a molecular weight of 239.18 g/mol. IUPAC name: adamantane-1,3-diamine;dihydrochloride. InChIKey: JFXXSCYTYFTSNO-UHFFFAOYSA-N.
| Molecular formula | C10H20Cl2N2 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | adamantane-1,3-diamine;dihydrochloride |
| InChIKey | JFXXSCYTYFTSNO-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
adamantane-1,3-diamine dihydrochloride, Tricyclo(3.3.1.1(sup 3,7))decane-1,3-diamine, dihydrochloride, adamantane-1,3-diamine;dihydrochloride, adamantane-1,3-diamine 2hcl, Adamantane-1,3-diaminedihydrochloride, Adamantane-1,3-diamine diHCl, JFXXSCYTYFTSNO-UHFFFAOYSA-N, 5.?1,3-adamantanediamine dihydrochloride, Adamantane-1,3-diamine--hydrogen chloride (1/2)