Products 265646-94-4
CAS 265646-94-4 is the registry number for NS3736. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (CAS 265646-94-4) is a chemical compound with the molecular formula C15H9BrClF3N6O and a molecular weight of 461.62 g/mol. IUPAC name: 1-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea. InChIKey: PTWUMGQRIORASC-UHFFFAOYSA-N.
| Molecular formula | C15H9BrClF3N6O |
|---|---|
| Molecular weight | 461.62 g/mol |
| IUPAC name | 1-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| InChIKey | PTWUMGQRIORASC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)NC2=C(C=C(C=C2)Br)C3=NNN=N3)C(F)(F)F)Cl |
Computed by PubChem (NCBI)