Products 265650-09-7

CAS 265650-09-7 is the registry number for Ethyl 2-amino-5-methoxy-4-methylthiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-5-methoxy-4-methylthiophene-3-carboxylate (CAS 265650-09-7) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: ethyl 2-amino-5-methoxy-4-methylthiophene-3-carboxylate. InChIKey: UYDOEMWXYZCHMX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO3S
Molecular weight215.27 g/mol
IUPAC nameethyl 2-amino-5-methoxy-4-methylthiophene-3-carboxylate
InChIKeyUYDOEMWXYZCHMX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC(=C1C)OC)N

Computed by PubChem (NCBI)