Products 2657617-90-6
CAS 2657617-90-6 is the registry number for 2,3,4,5-Tetrafluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,4,5-tetrafluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2657617-90-6) is a chemical compound with the molecular formula C12H14BF4NO2 and a molecular weight of 291.05 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: ATFYJCGWEXYXNI-UHFFFAOYSA-N.
| Molecular formula | C12H14BF4NO2 |
|---|---|
| Molecular weight | 291.05 g/mol |
| IUPAC name | 2,3,4,5-tetrafluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | ATFYJCGWEXYXNI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C(=C2F)F)F)F)N |
Computed by PubChem (NCBI)