Products 26579-54-4

CAS 26579-54-4 appears in our catalog under these names: Thieno[2,3-b]pyridin-3-amine, 95%, Thieno(2,3-b)pyridin-3-amine, 95+%, Thieno(2,3-b)pyridin-3-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 0,5g.

Structural formula: {0} (CAS {1})

Thieno[2,3-b]pyridin-3-amine (CAS 26579-54-4) is a chemical compound with the molecular formula C7H6N2S and a molecular weight of 150.20 g/mol. IUPAC name: thieno[2,3-b]pyridin-3-amine. InChIKey: FIJSXJNXPHKJIR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2S
Molecular weight150.20 g/mol
IUPAC namethieno[2,3-b]pyridin-3-amine
InChIKeyFIJSXJNXPHKJIR-UHFFFAOYSA-N
SMILESC1=CC2=C(N=C1)SC=C2N

Computed by PubChem (NCBI)