Products 2659308-31-1
CAS 2659308-31-1 is the registry number for MMB022. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
Methyl (2S)-3-methyl-2-[(1-pent-4-enylindole-3-carbonyl)amino]butanoate (CAS 2659308-31-1) is a chemical compound with the molecular formula C20H26N2O3 and a molecular weight of 342.4 g/mol. IUPAC name: methyl (2S)-3-methyl-2-[(1-pent-4-enylindole-3-carbonyl)amino]butanoate. InChIKey: RQVMOMGJHFPBNR-SFHVURJKSA-N.
| Molecular formula | C20H26N2O3 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | methyl (2S)-3-methyl-2-[(1-pent-4-enylindole-3-carbonyl)amino]butanoate |
| InChIKey | RQVMOMGJHFPBNR-SFHVURJKSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NC(=O)C1=CN(C2=CC=CC=C21)CCCC=C |
Computed by PubChem (NCBI)