CAS 2659374-76-0 is the registry number for (R)-((4,4-Dibromo-1-fluoro-2-methylbut-3-en-2-yl)oxy)triethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-4,4-dibromo-1-fluoro-2-methylbut-3-en-2-yl]oxy-triethylsilane (CAS 2659374-76-0) is a chemical compound with the molecular formula C11H21Br2FOSi and a molecular weight of 376.17 g/mol. IUPAC name: [(2R)-4,4-dibromo-1-fluoro-2-methylbut-3-en-2-yl]oxy-triethylsilane. InChIKey: GDHCPVLQUAKSHQ-LLVKDONJSA-N.
| Molecular formula | C11H21Br2FOSi |
|---|---|
| Molecular weight | 376.17 g/mol |
| IUPAC name | [(2R)-4,4-dibromo-1-fluoro-2-methylbut-3-en-2-yl]oxy-triethylsilane |
| InChIKey | GDHCPVLQUAKSHQ-LLVKDONJSA-N |
| SMILES | CC[Si](CC)(CC)O[C@@](C)(CF)C=C(Br)Br |
Computed by PubChem (NCBI)