CAS 26598-44-7 is the registry number for Ethybenztropine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,5S)-3-benzhydryloxy-8-ethyl-8-azabicyclo[3.2.1]octane;hydrochloride (CAS 26598-44-7) is a chemical compound with the molecular formula C22H28ClNO and a molecular weight of 357.9 g/mol. IUPAC name: (1R,5S)-3-benzhydryloxy-8-ethyl-8-azabicyclo[3.2.1]octane;hydrochloride. InChIKey: GTRBFCLXPXZLPA-ILOBMFFHSA-N.
| Molecular formula | C22H28ClNO |
|---|---|
| Molecular weight | 357.9 g/mol |
| IUPAC name | (1R,5S)-3-benzhydryloxy-8-ethyl-8-azabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | GTRBFCLXPXZLPA-ILOBMFFHSA-N |
| SMILES | CCN1[C@@H]2CC[C@H]1CC(C2)OC(C3=CC=CC=C3)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)