Products 265980-25-4

CAS 265980-25-4 is the registry number for SCH-202676 (hydrobromide), 96.81%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10mM/1mL, 100 mg, 25 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-methyl-2,3-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide (CAS 265980-25-4) is a chemical compound with the molecular formula C15H14BrN3S and a molecular weight of 348.3 g/mol. IUPAC name: N-methyl-2,3-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide. InChIKey: YJYGOWVFDGULLL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14BrN3S
Molecular weight348.3 g/mol
IUPAC nameN-methyl-2,3-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide
InChIKeyYJYGOWVFDGULLL-UHFFFAOYSA-N
SMILESCN=C1N=C(N(S1)C2=CC=CC=C2)C3=CC=CC=C3.Br

Computed by PubChem (NCBI)