Products 2660060-40-0
CAS 2660060-40-0 is the registry number for tert-Butyl (S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate (CAS 2660060-40-0) is a chemical compound with the molecular formula C15H28BNO4 and a molecular weight of 297.20 g/mol. IUPAC name: tert-butyl (3S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate. InChIKey: YADHEMOTVPFRIU-NSHDSACASA-N.
| Molecular formula | C15H28BNO4 |
|---|---|
| Molecular weight | 297.20 g/mol |
| IUPAC name | tert-butyl (3S)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | YADHEMOTVPFRIU-NSHDSACASA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@H]2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)