Products 2375930-89-3
CAS 2375930-89-3 is the registry number for tert-butyl N-[(3E)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-yl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]carbamate (CAS 2375930-89-3) is a chemical compound with the molecular formula C15H28BNO4 and a molecular weight of 297.20 g/mol. IUPAC name: tert-butyl N-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]carbamate. InChIKey: NNXLQFVUDBMHLY-CSKARUKUSA-N.
| Molecular formula | C15H28BNO4 |
|---|---|
| Molecular weight | 297.20 g/mol |
| IUPAC name | tert-butyl N-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enyl]carbamate |
| InChIKey | NNXLQFVUDBMHLY-CSKARUKUSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)