CAS 2660240-42-4 appears in our catalog under these names: N-(((Chloromethyl)dimethylsilyl)methyl)-4-methylbenzenesulfonamide, 98%, (((Chloromethyl)dimethylsilyl)methyl)-4-methylbenzenesulfonamide, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 100mg.
N-[[chloromethyl(dimethyl)silyl]methyl]-4-methylbenzenesulfonamide (CAS 2660240-42-4) is a chemical compound with the molecular formula C11H18ClNO2SSi and a molecular weight of 291.87 g/mol. IUPAC name: N-[[chloromethyl(dimethyl)silyl]methyl]-4-methylbenzenesulfonamide. InChIKey: PJYNGDLGOJQOMR-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO2SSi |
|---|---|
| Molecular weight | 291.87 g/mol |
| IUPAC name | N-[[chloromethyl(dimethyl)silyl]methyl]-4-methylbenzenesulfonamide |
| InChIKey | PJYNGDLGOJQOMR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC[Si](C)(C)CCl |
Computed by PubChem (NCBI)