Products 2662572-62-3
CAS 2662572-62-3 is the registry number for 5-Chloro-6-(4,4-difluorocyclohexyl)-3-pyridinamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-6-(4,4-difluorocyclohexyl)pyridin-3-amine (CAS 2662572-62-3) is a chemical compound with the molecular formula C11H13ClF2N2 and a molecular weight of 246.68 g/mol. IUPAC name: 5-chloro-6-(4,4-difluorocyclohexyl)pyridin-3-amine. InChIKey: CCDUOMQLYKAFGE-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF2N2 |
|---|---|
| Molecular weight | 246.68 g/mol |
| IUPAC name | 5-chloro-6-(4,4-difluorocyclohexyl)pyridin-3-amine |
| InChIKey | CCDUOMQLYKAFGE-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=C(C=C(C=N2)N)Cl)(F)F |
Computed by PubChem (NCBI)