CAS 2174000-29-2 is the registry number for 1-(5,6-Difluoro-1H-indol-3-yl)propan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(5,6-difluoro-1H-indol-3-yl)propan-2-amine;hydrochloride (CAS 2174000-29-2) is a chemical compound with the molecular formula C11H13ClF2N2 and a molecular weight of 246.68 g/mol. IUPAC name: 1-(5,6-difluoro-1H-indol-3-yl)propan-2-amine;hydrochloride. InChIKey: XYYYSJUBIOIMAT-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF2N2 |
|---|---|
| Molecular weight | 246.68 g/mol |
| IUPAC name | 1-(5,6-difluoro-1H-indol-3-yl)propan-2-amine;hydrochloride |
| InChIKey | XYYYSJUBIOIMAT-UHFFFAOYSA-N |
| SMILES | CC(CC1=CNC2=CC(=C(C=C21)F)F)N.Cl |
Computed by PubChem (NCBI)