CAS 2663787-26-4 appears in our catalog under these names: 3-(Cyanomethyl)-2-fluorobenzeneboronic acid, 95%, (3-(Cyanomethyl)-2-fluorophenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
[3-(cyanomethyl)-2-fluorophenyl]boronic acid (CAS 2663787-26-4) is a chemical compound with the molecular formula C8H7BFNO2 and a molecular weight of 178.96 g/mol. IUPAC name: [3-(cyanomethyl)-2-fluorophenyl]boronic acid. InChIKey: XGJBGDRHANIIGO-UHFFFAOYSA-N.
| Molecular formula | C8H7BFNO2 |
|---|---|
| Molecular weight | 178.96 g/mol |
| IUPAC name | [3-(cyanomethyl)-2-fluorophenyl]boronic acid |
| InChIKey | XGJBGDRHANIIGO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)CC#N)F)(O)O |
Computed by PubChem (NCBI)