CAS 2664977-46-0 is the registry number for cis-tert-Butyl 3,4-diaminopyrrolidine-1-carboxylate dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (3S,4R)-3,4-diaminopyrrolidine-1-carboxylate;hydrochloride (CAS 2664977-46-0) is a chemical compound with the molecular formula C9H20ClN3O2 and a molecular weight of 237.73 g/mol. IUPAC name: tert-butyl (3S,4R)-3,4-diaminopyrrolidine-1-carboxylate;hydrochloride. InChIKey: DWGIBVHYJXAUFQ-UKMDXRBESA-N.
| Molecular formula | C9H20ClN3O2 |
|---|---|
| Molecular weight | 237.73 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3,4-diaminopyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | DWGIBVHYJXAUFQ-UKMDXRBESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)N)N.Cl |
Computed by PubChem (NCBI)