CAS 2664977-59-5 is the registry number for Di-tert-butyl (R)-2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ditert-butyl (2R)-2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate (CAS 2664977-59-5) is a chemical compound with the molecular formula C17H30N2O6 and a molecular weight of 358.4 g/mol. IUPAC name: ditert-butyl (2R)-2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate. InChIKey: KHNDFFYHELWSII-GFCCVEGCSA-N.
| Molecular formula | C17H30N2O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | ditert-butyl (2R)-2-(2-methoxy-2-oxoethyl)piperazine-1,4-dicarboxylate |
| InChIKey | KHNDFFYHELWSII-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)CC(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)