Products 1381946-82-2

CAS 1381946-82-2 is the registry number for 1,4-Di-tert-butyl 2-methyl 1,4-diazepane-1,2,4-tricarboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O,4-O-ditert-butyl 2-O-methyl 1,4-diazepane-1,2,4-tricarboxylate (CAS 1381946-82-2) is a chemical compound with the molecular formula C17H30N2O6 and a molecular weight of 358.4 g/mol. IUPAC name: 1-O,4-O-ditert-butyl 2-O-methyl 1,4-diazepane-1,2,4-tricarboxylate. InChIKey: MSEZMIUXSKNYKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H30N2O6
Molecular weight358.4 g/mol
IUPAC name1-O,4-O-ditert-butyl 2-O-methyl 1,4-diazepane-1,2,4-tricarboxylate
InChIKeyMSEZMIUXSKNYKZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCN(C(C1)C(=O)OC)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)