CAS 2665007-78-1 is the registry number for 2,2,2-Trichloro-1-(5,6-dichloro-1H-indol-3-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trichloro-1-(5,6-dichloro-1H-indol-3-yl)ethanone (CAS 2665007-78-1) is a chemical compound with the molecular formula C10H4Cl5NO and a molecular weight of 331.4 g/mol. IUPAC name: 2,2,2-trichloro-1-(5,6-dichloro-1H-indol-3-yl)ethanone. InChIKey: GHDREYNGBFZGEW-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl5NO |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 2,2,2-trichloro-1-(5,6-dichloro-1H-indol-3-yl)ethanone |
| InChIKey | GHDREYNGBFZGEW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)NC=C2C(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)